| Identification | |
| Name: | 1,1-Cyclohexane diacetic anhydride |
| Synonyms: | 1,1-Cyclohexanediaceticanhydride (7CI,8CI);3,3-Pentamethyleneglutaric acid anhydride;3,3-Pentamethyleneglutaric anhydride;3-Oxaspiro[5.5]undecane-2,4-dione; |
| CAS: | 1010-26-0 |
| Molecular Formula: | C10H14O3 |
| Molecular Weight: | 182.21 |
| InChI: | InChI=1/C10H14O3/c11-8-6-10(7-9(12)13-8)4-2-1-3-5-10/h1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159.8°C |
| Boiling Point: | 336°Cat760mmHg |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.499 |
| Appearance: | White crystalline powder |
| Specification: |
Removal in wastewater treatment of 1,1-Cyclohexanediacetic anhydride (1010-26-0) can be stated as follows: |
| Flash Point: | 159.8°C |
| Safety Data | |
 |
|
