| Identification | |
| Name: | 1-(2-Fluorophenyl)piperazine |
| Synonyms: | Piperazine,1-(o-fluorophenyl)- (7CI,8CI);1-(o-Fluorophenyl)piperazine;4-(2-Fluorophenyl)piperazine;N-(2-Fluorophenyl)piperazine;Piperazine,1-(2-fluorophenyl)-; |
| CAS: | 1011-15-0 |
| EINECS: | 213-780-4 |
| Molecular Formula: | C10H13FN2 |
| Molecular Weight: | 180.22 |
| InChI: | InChI=1/C10H13FN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 125.4 °C |
| Density: | 1.141 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.555-1.558 |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
1-(2-Fluorophenyl)piperazine (CAS NO.1011-15-0), its Synonyms are 2-(1-Piperazino)fluorobenzene ; 1-(2-Fluorophenyl)piperazine 97% ; 1-(2-Fluorophenyl)piperazine hydrochloride ; Piperazine, 1-(2-fluorophenyl)- . |
| Packinggroup: | II |
| Flash Point: | 125.4 °C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
