| Identification | |
| Name: | 1H-Purine-2,6-dione,3,7-dihydro-7-hydroxy-1,3-dimethyl- |
| Synonyms: | Theophylline,7-hydroxy- (7CI,8CI); 7-Hydroxytheophylline |
| CAS: | 1012-82-4 |
| Molecular Formula: | C7H8 N4 O3 |
| Molecular Weight: | 196.19 |
| InChI: | InChI=1/C7H8N4O3/c1-9-5-4(11(14)3-8-5)6(12)10(2)7(9)13/h3,14H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 239.4°C |
| Boiling Point: | 472.2°Cat760mmHg |
| Density: | 1.69g/cm3 |
| Refractive index: | 1.745 |
| Specification: |
7-Hydroxytheophyllin with cas registry number of 1012-82-4 is also known as 1H-Purine-2,6-dione, 3,7-dihydro-7-hydroxy-1,3-dimethyl-(9CI) ; Theophylline, 7-hydroxy- . 7-Hydroxytheophyllin with cas registry number of 1012-82-4 is a tumorigen used in research. It is also used as an intermediate . |
| Flash Point: | 239.4°C |
| Safety Data | |
 |
|
