Identification |
Name: | Pyrrolo[2,3-b]indol-5-ol,1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-phenylcarbamate), (3aS,8aR)- |
Synonyms: | Pyrrolo[2,3-b]indol-5-ol,1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, phenylcarbamate (ester), (3aS,8aR)-(9CI); Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-,phenylcarbamate (ester), (3aS-cis)-; (-)-Eseroline phenylcarbamate;(-)-Phenserine; Phenserine |
CAS: | 101246-66-6 |
Molecular Formula: | C20H23 N3 O2 |
Molecular Weight: | 337.4155 |
InChI: | InChI=1/C20H23N3O2/c1-20-11-12-22(2)18(20)23(3)17-10-9-15(13-16(17)20)25-19(24)21-14-7-5-4-6-8-14/h4-10,13,18H,11-12H2,1-3H3,(H,21,24)/t18-,20+/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 237.3°C |
Boiling Point: | 468.7°Cat760mmHg |
Density: | 1.228g/cm3 |
Refractive index: | 1.633 |
Biological Activity: | Physostigmine analog that inhibits acetylcholinesterase. Inhibits production of amyloid precursor protein (APP) and A β . Improves morris water maze performance of scopolamine-treated rats. |
Flash Point: | 237.3°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
|