| Identification | |
| Name: | Euchrysine 3RX |
| Synonyms: | 3,6-Acridinediamine,N,N,N',N'-tetramethyl-,monohydrochloride,compd. with zinc chloride (ZnCl2);Basic Orange 14;Acridine Orange, hemi(zinc chloride) salt;Acridine orange, hemizinc salt; |
| CAS: | 10127-02-3 |
| EINECS: | 233-353-6 |
| Molecular Formula: | C17H19N3.xCl2Zn.ClH |
| Molecular Weight: | 438.13 |
| InChI: | InChI=1/C17H19N3.3ClH.Zn/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14;;;;/h5-11H,1-4H3;3*1H;/q;;;;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. Hygroscopic. |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | brown powder |
| Packinggroup: | I; II; III |
| HS Code: | 32041300 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
