| Identification |
| Name: | D-Proline, 1-amino-(9CI) |
| Synonyms: | Proline,1-amino-, D- (8CI); 1-Amino-D-proline |
| CAS: | 10139-05-6 |
| Molecular Formula: | C5H10 N2 O2 |
| Molecular Weight: | 130.1451 |
| InChI: | InChI=1/C5H10N2O2/c6-7-3-1-2-4(7)5(8)9/h4H,1-3,6H2,(H,8,9)/t4-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 121.3°C |
| Boiling Point: | 277°Cat760mmHg |
| Density: | 1.306g/cm3 |
| Refractive index: | 1.548 |
| Flash Point: | 121.3°C |
| Usage: | Hydrolysis of the vitamin B6 antagonist linatine, produces the toxic compound,1-amino-D-proline. The compound possesses bacteriostatic effect toward A. vinelandii. The mechanism by which aminoproline exerts its toxic effects is unknown |
| Safety Data |
| |
 |
