| Identification | |
| Name: | Trenbolone |
| Synonyms: | Estra-4,9,11-trien-3-one,17b-hydroxy- (7CI,8CI);(+)-Trenbolone;17b-Hydroxyestra-4,9,11-trien-3-one;17b-Trenbolone;9,10,11,12-Dehydro-19-nortestosterone;RU2341;Estra-4,9,11-trien-3-one,17-hydroxy-, (17b)-;Trienbolone;b-Trenbolone; |
| CAS: | 10161-33-8 |
| Molecular Formula: | C18H22O2 |
| Molecular Weight: | 270.37 |
| InChI: | InChI=1/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-17,20H,2-7H2,1H3/t15-,16+,17+,18+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.19 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.605 |
| Solubility: | 43 mg/L (25 C) |
| Appearance: | DEA Schedule III item. |
| Specification: |
?Trenbolone , its cas register number 10161-33-8. It also can be called?17-beta-Hydroxyestra-4,9,11-trien-3-one ; 17-beta-Trenbolone ; 17beta-Trenbolone ; Trembolona ; Trembolona [INN-Spanish] ; Trenbolonum ; Trenbolonum [INN-Latin] ; and Trienbolone .?Its classification code are?Anabolic Agents; Hormone; Hormones; Hormones, Hormone Substitutes, and Hormone Antagonists and?Mutation data. |
| Usage: | A steroid used by veterinarians on livestock to increase muscle growth and appetite. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
