| Identification | |
| Name: | Acetamide,N-(2-chlorophenyl)-2-[ethyl[2-(1-piperidinyl)ethyl]amino]-, hydrochloride (1:2) |
| Synonyms: | Acetamide,N-(2-chlorophenyl)-2-[ethyl[2-(1-piperidinyl)ethyl]amino]-, dihydrochloride(9CI); Acetanilide, 2'-chloro-2-[ethyl(2-piperidinoethyl)amino]-,dihydrochloride (6CI) |
| CAS: | 101651-64-3 |
| Molecular Formula: | C17H26 Cl N3 O . 2 Cl H |
| Molecular Weight: | 396.83 |
| InChI: | InChI=1/C17H26ClN3O.2ClH/c1-2-20(12-13-21-10-6-3-7-11-21)14-17(22)19-16-9-5-4-8-15(16)18;;/h4-5,8-9H,2-3,6-7,10-14H2,1H3,(H,19,22);2*1H |
| Molecular Structure: | ![(C17H26ClN3O.2ClH) Acetamide,N-(2-chlorophenyl)-2-[ethyl[2-(1-piperidinyl)ethyl]amino]-, dihydrochloride(9CI); Acetanil...](https://img1.guidechem.com/chem/e/dict/41/101651-64-3.jpg) |
| Properties | |
| Flash Point: | 242.9°C |
| Boiling Point: | 478.1°C at 760 mmHg |
| Specification: |
2′-Chloro-2-(ethyl(2-piperidinoethyl)-amino)acetanilide dihydrochloride (CAS NO.101651-64-3) is a highly toxic chemical,so it could stimulate the eyes, with flammability, when heated to decomposition it emits toxic fumes of NOx and HCl, so it needed to be stored in low temperature, ventilation, drying and oxidability environmental condition, separated with food ingredients , water, carbon dioxide , dry powder, sand, water mist fire extinguishing can be used if urgency. |
| Flash Point: | 242.9°C |
| Safety Data | |
 |
|
