| Identification | |
| Name: | 1-Piperidineacetamide,N-ethyl-2-methyl-N-(1-methyl-2-phenoxyethyl)-, hydrochloride (1:1) |
| Synonyms: | 1-Piperidineacetamide,N-ethyl-2-methyl-N-(1-methyl-2-phenoxyethyl)-, monohydrochloride (9CI) |
| CAS: | 101651-79-0 |
| Molecular Formula: | C19H30 N2 O2 . Cl H |
| Molecular Weight: | 354.97 |
| InChI: | InChI=1/C19H30N2O2.ClH/c1-4-21(16(2)15-23-18-11-7-5-8-12-18)19(22)17(3)20-13-9-6-10-14-20;/h5,7-8,11-12,16-17H,4,6,9-10,13-15H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 223.1°C |
| Boiling Point: | 445.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
N-Ethyl-N-(1-phenoxy-2-propyl)-2-(2-methylpiperidino)acetamide hydrochloride , its cas register number is 101651-79-0. It also can be called C 2054 ; Acetamide, N-ethyl-2-(methylpiperidino)-N-(1-phenoxy-2-propyl)-, hydrochloride . N-Ethyl-N-(1-phenoxy-2-propyl)-2-(2-methylpiperidino)acetamide hydrochloride (CAS NO.101651-79-0) will cause an eye irritant. When heated to decomposition it emits very toxic fumes of NOx and HCl. |
| Flash Point: | 223.1°C |
| Safety Data | |
 |
|
