| Identification | |
| Name: | 1H-Pyrrole,3-chloro-4-(3-chloro-2-nitrophenyl)- |
| Synonyms: | Pyrrole,3-chloro-4-(3-chloro-2-nitrophenyl)- (7CI,8CI);3-Chloro-4-(3-chloro-2-nitrophenyl)pyrrole; 3-Chloro-4-(3'-chloro-2'-nitrophenyl)pyrrole;NSC 107654; NSC 637277; PN; Pyroace; Pyrrolnitrin; Pyrrolnitrine |
| CAS: | 1018-71-9 |
| EINECS: | 213-812-7 |
| Molecular Formula: | C10H6 Cl2 N2 O2 |
| Molecular Weight: | 257.08 |
| InChI: | InChI=1/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.1°C |
| Boiling Point: | 410.5°Cat760mmHg |
| Density: | 1.523g/cm3 |
| Refractive index: | 1.65 |
| Specification: |
3-Chloro-4-(3-chloro-2-nitrophenyl) pyrrole (CAS NO.1018-71-9) is also called 3-Chloro-4-(2'-nitro-3'-chlorophenyl)pyrrole ; 5-20-07-00373 (Beilstein Handbook Reference) ; BRN 1287646 ; FR 005759 ; NSC 107654 ; Pirrolnitrina [INN-Spanish] ; Pyroace ; Pyrrolnitrine [INN-French] ; Pyrrolnitrinum [INN-Latin] ; 1H-Pyrrole, 3-chloro-4-(3-chloro-2-nitrophenyl)- ; Pyrrole, 3-chloro-4-(3-chloro-2-nitrophenyl)- ; Pyrrolnitrin . 3-Chloro-4-(3-chloro-2-nitrophenyl) pyrrole (CAS NO.1018-71-9) is moderate toxic. It is flammable. It will produce toxic nitrogen oxide and nitric oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 202.1°C |
| Safety Data | |
 |
|
