| Identification | |
| Name: | 2-Propenoic acid,potassium salt (1:1) |
| Synonyms: | 2-Propenoicacid, potassium salt (9CI);Acrylic acid, potassium salt (8CI);Potassium2-propenoate;Potassium acrylate;Potassium prop-2-enoate; |
| CAS: | 10192-85-5 |
| EINECS: | 233-473-9 |
| Molecular Formula: | C3H4O2.K |
| Molecular Weight: | 110.15 |
| InChI: | InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°Cat760mmHg |
| Density: | 1.063g/cm3 |
| Solubility: | Miscible with alcohol, and ether Miscible with ethanol, ethyl ether; soluble in acetone, benzene, carbon tetrachloride Miscible with chloroform Miscible with water /1X10+6 mg/L/ at 25 deg C |
| Appearance: | White to slightly brown solid |
| Flash Point: | 61.6°C |
| Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
| Safety Data | |
 |
|
