| Identification | |
| Name: | Zinc nitrate hexahydrate |
| Synonyms: | Nitricacid, zinc salt, hexahydrate (8CI,9CI);Nitric acid, zinc salt,hydrate (2:1:6);Zincnitrate (Zn(NO3)2), hexahydrate;Zinc nitratehexahydrate (Zn(NO3)2.6H2O); |
| CAS: | 10196-18-6 |
| EINECS: | 231-943-8 |
| Molecular Formula: | Zn(NO3)2.6(H2O) |
| Molecular Weight: | 297.51 |
| InChI: | InChI=1/NO3.6H2O.Zn/c2-1(3)4;;;;;;;/h;6*1H2;/q-1;;;;;;;+2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1514 |
| Water Solubility: | 1800 G/L (20 ºC) |
| Appearance: | white crystal |
| Specification: |
Zinc nitrate hexahydrate (CAS NO.10196-18-6) is also named as CCRIS 8894 ; Dusicnan zinecnaty ; Dusicnan zinecnaty [Czech] ; Nitric acid, zinc salt, hexahydrate ; Zinc(II) nitrate, hexahydrate (1:2:6) . Zinc nitrate hexahydrate (CAS NO.10196-18-6) is white crystal. It is soluble in water and ethanol . |
| Report: |
Zinc and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
O: Oxidizing agent
Xn: Harmful
|
 |
|
