Identification |
Name: | 3(2H)-Pyridazinone,6-[4-(difluoromethoxy)-3-methoxyphenyl]- |
Synonyms: | Zardaverine;6-(4-(Difluoromethoxy)-3-methoxyphenyl)-3(2H)-pyridazinone;Zardaverina;Zardaverinum; |
CAS: | 101975-10-4 |
Molecular Formula: | C12H10F2N2O3 |
Molecular Weight: | 268.22 |
InChI: | InChI=1/C12H10F2N2O3/c1-18-10-6-7(2-4-9(10)19-12(13)14)8-3-5-11(17)16-15-8/h2-6,12H,1H3,(H,16,17) |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.38g/cm3 |
Refractive index: | 1.554 |
Biological Activity: | Phosphodiesterase inhibitor, selective for PDE3 and 4 (IC 50 values are 0.5 and 0.8 μ M respectively). Also available as part of the Phosphodiesterase Inhibitor Tocriset™ . |
Flash Point: | °C |
Safety Data |
|
|