| Identification | ||
| Name: | Thiocarbanilide | |
| Synonyms: | sym-Diphenylthiourea; N,N-Diphenylthiourea (sym.); 1,3-Diphenylthiourea DPTU; N,N-Diphenylthiourea; N,N'Diphenylthiourea; 1,2-Diphenyl-2-thiourea; 1,3-Difenylthiomocovina; 1,3-diphenyl-2-thio-ure; 2-Fenylotiomocznik; N,N'-Diphenylthiourea | |
| CAS: | 102-08-9 | |
| EINECS: | 203-004-2 | |
| Molecular Formula: | C13H12N2S | |
| Molecular Weight: | 228.31 | |
| InChI: | InChI=1/C13H12N2S/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15,16) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2811 | |
| Flash Point: | 164.7°C | |
| Density: | 1.32 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.748 | |
| Water Solubility: | <0.01 g/100 mL at 19 ºC | |
| Solubility: | <0.01 g/100 mL at 19 ºC | |
| Appearance: | white powder | |
| Specification: |
Thiocarbanilide , its cas register number is 102-08-9. It also can be called N,N'-Diphenylthiourea ; sym-Diphenylthiourea ; and 1,3-Diphenyl-2-thiourea . It is hazardous, so the first aid measures and others should be known. Such as: When on the skin: first, should flush skin with plenty of water immediately for at least 15 minutes while removing contaminated clothing. Secondly, get medical aid. Or in the eyes: Flush eyes with plenty of water for at least 15 minutes, occasionally lifting the upper and lower eyelids. Then get medical aid soon. While, it's inhaled: Remove from exposure and move to fresh air immediately. Then you have the ingesting of the product: If victim is conscious and alert, give 2-4 cupfuls of milk or water. In addition, Thiocarbanilide (CAS NO.102-08-9) could be stable under normal temperatures and pressures. And also prevent it to broken down into hazardous decomposition products: nitrogen oxides, carbon monoxide, oxides of sulfur, carbon dioxide, nitrogen. | |
| Report: |
Reported in EPA TSCA Inventory. | |
| Packinggroup: | II | |
| HS Code: | 29309070 | |
| Flash Point: | 164.7°C | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | CRYSTALLINE LEAFLETS GRAY POWDER WHITE TO FAINT GRAY POWDER | |
| Usage: | Vulcanizing accelerator, sulfur dyes. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
