| Identification | |
| Name: | Butanoic acid,4-oxo-4-(phenylamino)- |
| Synonyms: | 4-Oxo-4-(phenylamino)butanoic acid;N-Phenylsuccinamidic acid;4-Anilino-4-oxobutanoic acid; |
| CAS: | 102-14-7 |
| Molecular Formula: | C10H11NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H11NO3/c12-9(6-7-10(13)14)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 233.4°C |
| Boiling Point: | 462.3°C at 760 mmHg |
| Density: | 1.286g/cm3 |
| Refractive index: | 1.599 |
| Specification: | White Solid usageEng:The metabolite (MII) of Suberoylanilide Hydroxamic Acid (S688700). |
| Flash Point: | 233.4°C |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Usage: | The metabolite (MII) of Suberoylanilide Hydroxamic Acid (S688700). |
| Safety Data | |
 |
|
