| Identification | |
| Name: | Benzeneacetic acid,(4-methoxyphenyl)methyl ester |
| Synonyms: | Aceticacid, phenyl-, p-methoxybenzyl ester (8CI); Benzyl alcohol, p-methoxy-,phenylacetate; 4-Methoxybenzyl phenylacetate; Anisyl phenylacetate;Phenylacetic acid, p-methoxybenzyl ester; p-Methoxybenzyl phenylacetate |
| CAS: | 102-17-0 |
| EINECS: | 203-010-5 |
| Molecular Formula: | C16H16 O3 |
| Molecular Weight: | 256.3 |
| InChI: | InChI=1/C16H16O3/c1-18-15-9-7-14(8-10-15)12-19-16(17)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.2°C |
| Boiling Point: | 374.8°Cat760mmHg |
| Density: | 1.129g/cm3 |
| Refractive index: | n20/D 1.559 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 157.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
