| Identification | |
| Name: | Benzeneacetic acid,2-phenylethyl ester |
| Synonyms: | Benzylcarbinyl a-toluate;NSC 6676;Phenethyl phenylacetate;Phenylethyl phenylacetate;b-Phenylethyl phenylacetate;Aceticacid, phenyl-, phenethyl ester (6CI,7CI,8CI);2-Phenylethyl phenylacetate; |
| CAS: | 102-20-5 |
| EINECS: | 203-013-1 |
| Molecular Formula: | C16H16O2 |
| Molecular Weight: | 240.3 |
| InChI: | InChI=1/C16H16O2/c17-16(13-15-9-5-2-6-10-15)18-12-11-14-7-3-1-4-8-14/h1-10H,11-13H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.082 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.55 |
| Solubility: | Insoluble |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Keep tightly closed. Store in a cool dry place. |
| Usage: | Food additive. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
