| Identification | |
| Name: | 1,3-Benzenediol,1-acetate |
| Synonyms: | 1,3-Benzenediol,monoacetate (9CI); Resorcinol, acetate (6CI,7CI); Resorcinol, monoacetate(8CI); 3-(Acetyloxy)phenol; 3-Acetoxyphenol; Acetic acid 3-hydroxyphenyl ester;Acetylresorcinol; Euresol; NSC 40511; Remonol; Resorcin acetate; Resorcinmonoacetate; Resorcitate; m-Hydroxyphenyl acetate |
| CAS: | 102-29-4 |
| EINECS: | 203-022-0 |
| Molecular Formula: | C8H8 O3 |
| Molecular Weight: | 152.16 |
| InChI: | InChI=1/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 129-133 oC |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.537(lit.) |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | clear brown to yellow brown viscous liquid |
| Specification: | clear yellow to brown viscous liquid Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
