| Identification | |
| Name: | 3,4-dichlorophenyl isocyanate |
| Synonyms: | 1,2-Dichloro-4-phenyl isocyanate; Isocyanic acid 3,4-dichlorophenyl ester; Dichlorophenyl-3,4-isocyanate; 1,2-dichloro-4-isocyanato-benzen; 1,2-Dichloro-4-isocyanatobenzene; 3,4-Dichlorfenylisokyanat; 3,4-Dichlorphenylisocyanate; benzene,1,2-dichloro-4-isocyanato; benzene,1,2-dichloro-4-isocyanato-; benzene,1,2-dichloro-4isocyanato-; dcpi |
| CAS: | 102-36-3 |
| EINECS: | 203-026-2 |
| Molecular Formula: | C7H3Cl2NO |
| Molecular Weight: | 188.01 |
| InChI: | InChI=1/C7H3Cl2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2250 |
| Density: | 1.37g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.575 |
| Water Solubility: | decomposes |
| Solubility: | decomposes in water |
| Appearance: | Clear waxy solid |
| Specification: | White low melting solid Safety Statements:22-26-36/37/39-45 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29291090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Color: | WHITE TO YELLOW CRYSTALLINE SOLID |
| Usage: | Chemical intermediate, organic synthesis. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
