| Identification | |
| Name: | 2-Methyl-4-Methoxyaniline |
| Synonyms: | 2-amino-5-methoxytoluene; 2-methyl-p-anisidine; meta-Cresidine; 4-methoxy-2-methylaniline; 2-Methyl-4-methoxybenzenamine |
| CAS: | 102-50-1 |
| EINECS: | 203-036-7 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-6-5-7(10-2)3-4-8(6)9/h3-5H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.065 |
| Stability: | Stable. May be light or air-sensitive. Combustible. Incompatible with acids, strong oxidizing agents. |
| Refractive index: | 1.5675-1.5695 |
| Water Solubility: | insoluble, |
| Solubility: | insoluble, <0.1 g/100 mL at 21.5 ºC |
| Appearance: | brick red crystals or liquid |
| Specification: | brick red crystals or liquid Safety Statements:26-36/37/39-53-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Color: | Crystals from ligroin |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
