| Identification | |
| Name: | 1,2-Benzenediamine,4-methoxy- |
| Synonyms: | o-Phenylenediamine,4-methoxy- (6CI,7CI,8CI);1,2-Diamino-4-methoxybenzene;3,4-Diaminoanisole;4-Methoxy-1,2-benzenediamine;4-Methoxy-1,2-diaminobenzene;4-Methoxy-1,2-phenylenediamine;4-Methoxy-2-aminoaniline;4-Methoxy-o-phenylenediamine;p-Methoxy-o-phenylenediamine; |
| CAS: | 102-51-2 |
| Molecular Formula: | C7H10N2O |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C7H10N2O/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 161.7°C |
| Boiling Point: | 302.4°Cat760mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.619 |
| Appearance: | Dark brownish black solid |
| Specification: | Dark Brownish Black Solid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. Community Right-To-Know List. |
| Flash Point: | 161.7°C |
| Storage Temperature: | Refrigerator, under inert atmosphere |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
