| Identification | |
| Name: | 1,1,3,3-Tetramethoxypropane |
| Synonyms: | Malonaldehyde,bis(dimethyl acetal) (6CI,7CI,8CI);AI3-28938;Malonaldehyde tetramethyl acetal;NSC 27794;Tetramethoxypropane;Propane, 1,1,3,3-tetramethoxy-; |
| CAS: | 102-52-3 |
| EINECS: | 203-037-2 |
| Molecular Formula: | C7H16O4 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C7H16O4/c1-8-6(9-2)5-7(10-3)11-4/h6-7H,5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 0.997 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.406-1.408 |
| Water Solubility: | IMMISCIBLE |
| Solubility: | Immiscible |
| Appearance: | clear colourless to yellow-brown liquid |
| Specification: | clear colourless to yellow-brown liquid Safety Statements:16-26-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29110000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
