| Identification | |
| Name: | Tripropylamine |
| Synonyms: | Trinpropylamine; N,N-Dipropyl-1-propanamine; (n-C3H7)3N; 1-Propanamine,N,N-dipropyl-; n,n-dipropyl-1-propanamin; N,N-Dipropyl-1-propylamine; N,N-Dipropylpropanamine; Propyldi-n-propylamine; Tripropylamin; tripropylamine,[flammableliquidlabel]; 3-propylamine |
| CAS: | 102-69-2 |
| EINECS: | 203-047-7 |
| Molecular Formula: | C9H21N |
| Molecular Weight: | 143.27 |
| InChI: | InChI=1/C9H21N/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2260 |
| Density: | 0.757 |
| Stability: | Stable. Incompatible with acids, oxidizing agents. Protect from moisture. Flammable. |
| Refractive index: | 1.4155-1.4175 |
| Solubility: | 2.6 g/L (20 oC) |
| Appearance: | Colourless to fishy liquid |
| Specification: | colourless liquid Safety Statements:26-36/37/39-45-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29211980 |
| Storage Temperature: | Flammables area |
| Color: | Water white liquid Colorless liquid |
| Usage: | Used to prepare zeolite-type catalysts. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
