| Identification | |
| Name: | 2-Propen-1-amine,N,N-di-2-propen-1-yl- |
| Synonyms: | 2-Propen-1-amine,N,N-di-2-propenyl- (9CI);Triallylamine (6CI,7CI,8CI);N,N-Di-2-propenyl-2-propen-1-amine;Tris(2-propenyl)amine; |
| CAS: | 102-70-5 |
| EINECS: | 203-048-2 |
| Molecular Formula: | C9H15N |
| Molecular Weight: | 137.22 |
| InChI: | InChI=1/C9H15N/c1-4-7-10(8-5-2)9-6-3/h4-6H,1-3,7-9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2610 |
| Density: | 0.808g/cm3 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.451(lit.) |
| Water Solubility: | 250 g/100 mL |
| Solubility: | 250 g/100 mL |
| Appearance: | dark brown liquid |
| Specification: | dark brown liquid Safety Statements:16-26-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Color: | Liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
