| Identification | |
| Name: | Ethanol,2,2',2''-nitrilotris- |
| Synonyms: | Ethanol,2,2',2''-nitrilotri- (8CI);2,2',2''-Nitrilotriethanol;2,2',2''-Nitrilotris[ethanol];2-[Bis(2-hydroxyethyl)amino]ethanol;Alkanolamine244;Biafine;Daltogen;NSC 36718;Nitrilotriethanol;S 80;S 80 (amine);Sterolamide;Sting-Kill;TEA (amino alcohol);TEOA;Triethanolamin;Tris(2-hydroxyethyl)amine;Tris(b-hydroxyethyl)amine;Tris-amino Ultra PC;Trolamine;tris-(2-Hydroxyethyl)amine; |
| CAS: | 102-71-6 |
| EINECS: | 203-049-8 |
| Molecular Formula: | C6H15NO3 |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 |
| Molecular Structure: | ![(C6H15NO3) Ethanol,2,2',2''-nitrilotri- (8CI);2,2',2''-Nitrilotriethanol;2,2',2''-Nitrilotris[ethanol];2-[Bis(2...](https://img.guidechem.com/casimg/102-71-6.gif) |
| Properties | |
| Density: | 1.1245 |
| Refractive index: | 1.484-1.486 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Colorless to light yellow, viscous liquid |
| Specification: | Clear, amber viscous liquid Safety Statements:26-39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 36:Wear suitable protective clothing |
| HS Code: | 29221310 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Air Sensitive & Hygroscopic |
| Color: | Viscous liquid Colorless Pale-yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
