| Identification | |
| Name: | 3-(Di-n-butylamino)propylamine |
| Synonyms: | N,N-Dibutyl-1,3-propanediamine; 3-aminopropyldibutylamine; 3-(di-n-butylamino)proylamine; N,N-Di-n-butyl-1,3-propylenediamine; RARECHEM AL BW 1134; N,N'-DI-N-BUTYL-1,3-PROPANEDIAMINE; N,N-DI-N-BUTYL-1,3-PROPANEDIAMINE; N,N-DIBUTYLTRIMETHYLENEDIAMINE; N,N-DIBUTYL-1,3-DIAMINOPROPANE; 3-(di-Normal-butylamino)-propylamine |
| CAS: | 102-83-0 |
| EINECS: | 203-059-2 |
| Molecular Formula: | C11H26N2 |
| Molecular Weight: | 186.34 |
| InChI: | InChI=1/C11H26N2/c1-3-5-9-13(10-6-4-2)11-7-8-12/h3-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 |
| Density: | 0.827 |
| Refractive index: | 1.4455-1.4475 |
| Appearance: | Colorless clear lliquid |
| Specification: | Clear colourless liquid Safety Statements:26-36/37/39-45-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
