Identification |
Name: | 1-Dodecanamine,N,N-didodecyl- |
Synonyms: | Tridodecylamine(6CI,8CI);Adogen 360;Alamine 304;Alamine 304-1;Armeen 312;N,N-Didodecyl-1-dodecanamine;NSC 35134;Tri-n-dodecylamine;Trilaurylamine;Tris(dodecyl)amine; |
CAS: | 102-87-4 |
EINECS: | 203-063-4 |
Molecular Formula: | C36H75N |
Molecular Weight: | 521.9874 |
InChI: | InChI=1S/C36H75N/c1-4-7-10-13-16-19-22-25-28-31-34-37(35-32-29-26-23-20-17-14-11-8-5-2)36-33-30-27-24-21-18-15-12-9-6-3/h4-36H2,1-3H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 16 °C
|
Flash Point: | 256.6°C |
Boiling Point: | 220-228 °C0.03 mm Hg(lit.)
|
Density: | 0.828g/cm3 |
Refractive index: | n20/D 1.4578(lit.) |
Appearance: | clear slightly yellow liquid |
Specification: | clear slightly yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 256.6°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|