| Identification | |
| Name: | Cinnamoyl chloride |
| Synonyms: | 3-Phenyl-2-propenoyl chloride |
| CAS: | 102-92-1 |
| EINECS: | 203-065-5 |
| Molecular Formula: | C9H7ClO |
| Molecular Weight: | 166.61 |
| InChI: | InChI=1/C9H7ClO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.199 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.614 (20 C) |
| Water Solubility: | DECOMPOSES |
| Solubility: | dioxane: 0.1 g/mL, clear |
| Appearance: | White crystal |
| Packinggroup: | III |
| Usage: | Titrimetric determination of small amts of water. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
