| Identification | |
| Name: | Benzene,(2-nitroethenyl)- |
| Synonyms: | Styrene, b-nitro- (8CI);(2-Nitroethenyl)benzene; (2-Nitrovinyl)benzene; 1-Nitro-2-phenylethene;1-Nitro-2-phenylethylene; 1-Phenyl-2-nitroethene; 2-Nitro-1-phenylethylene;2-Phenyl-1-nitroethene; NSC 9809; b-Nitrostyrene; w-Nitrostyrene |
| CAS: | 102-96-5 |
| EINECS: | 203-066-0 |
| Molecular Formula: | C8H7 N O2 |
| Molecular Weight: | 149.16 |
| InChI: | InChI=1/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 55-58 °C(lit.) |
| Flash Point: | 117.5°C |
| Boiling Point: | 250-260 °C(lit.) |
| Density: | 1.177g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. May be sensitive to prolonged exposure to air. |
| Refractive index: | 1.603 |
| Appearance: | yellow crystals |
| Specification: | yellow crystals Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 117.5°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
