| Identification |
| Name: | Benzenemethanamine,N-(1-methylethyl)- |
| Synonyms: | Benzylamine,N-isopropyl- (6CI,7CI,8CI);(1-Methylethyl)(phenylmethyl)amine;Benzylisopropylamine;Isopropylbenzylamine;N-(1-Methylethyl)benzenemethanamine;N-Benzyl-N-isopropylamine;N-Benzylpropan-2-amine;N-Isopropyl-N-benzylamine;N-Isopropylbenzylamine;NSC 60295; |
| CAS: | 102-97-6 |
| EINECS: | 203-067-6 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-9(2)11-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2735 |
| Density: | 0.892 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.502 |
| Solubility: | Very soluble |
| Appearance: | Colorless clear liquid |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
