| Identification | |
| Name: | 2-Pyridinamine,3-methoxy- |
| Synonyms: | Pyridine,2-amino-3-methoxy- (7CI,8CI);(3-Methoxypyridin-2-yl)amine;3-(Methyloxy)-2-pyridinamine;3-Methoxypyridin-2-amine; |
| CAS: | 10201-71-5 |
| Molecular Formula: | C6H8N2O |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C6H8N2O/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.14 g/cm3 |
| Refractive index: | 1.561 |
| Specification: |
The 2-Amino-3-methoxypyridine with the CAS number 10201-71-5 is also called 2-Pyridinamine,3-methoxy-. Both the systematic name and IUPAC name are 3-methoxypyridin-2-amine. Its molecular formula is C6H8N2O. This chemical belongs to the following product categories: (1)Pyridine series; (2)Amines; (3)Pyridines; (4)API intermediates; (5)Pyridine. The properties of the chemical are: (1)ACD/LogP: 0.82; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 2; (6)ACD/BCF (pH 7.4): 5; (7)ACD/KOC (pH 5.5): 44; (8)ACD/KOC (pH 7.4): 106; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 48.14 Å2; (13)Index of Refraction: 1.561; (14)Molar Refractivity: 35.259 cm3; (15)Molar Volume: 108.94 cm3; (16)Polarizability: 13.978×10-24cm3; (17)Surface Tension: 46.14 dyne/cm; (18)Enthalpy of Vaporization: 47.175 kJ/mol; (19)Vapour Pressure: 0.051 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
