Identification |
Name: | Carbamimidothioic acid,2-(1H-imidazol-5-yl)ethyl ester |
Synonyms: | Carbamimidothioicacid, 2-(1H-imidazol-4-yl)ethyl ester (9CI);Imetit;SKF 91105;VUF 8325; |
CAS: | 102203-18-9 |
Molecular Formula: | C6H10 N4 S |
Molecular Weight: | 170.2354 |
InChI: | InChI=1S/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10) |
Molecular Structure: |
 |
Properties |
Melting Point: | 212-213ºC |
Density: | 1.44 g/cm3 |
Refractive index: | 1.695 |
Water Solubility: | Soluble to 15 mM in water |
Solubility: | Soluble to 15 mM in water |
Appearance: | off-white Solid |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |