| Identification |
| Name: | Carbamimidothioic acid,2-(1H-imidazol-5-yl)ethyl ester |
| Synonyms: | Carbamimidothioicacid, 2-(1H-imidazol-4-yl)ethyl ester (9CI);Imetit;SKF 91105;VUF 8325; |
| CAS: | 102203-18-9 |
| Molecular Formula: | C6H10 N4 S |
| Molecular Weight: | 170.2354 |
| InChI: | InChI=1S/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 212-213ºC |
| Density: | 1.44 g/cm3 |
| Refractive index: | 1.695 |
| Water Solubility: | Soluble to 15 mM in water |
| Solubility: | Soluble to 15 mM in water |
| Appearance: | off-white Solid |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
