| Identification | |
| Name: | 2-Pyrimidinamine,4-[2-[bis(2-methylpropyl)amino]ethoxy]- |
| Synonyms: | Pyrimidine,2-amino-4-(2-diisobutylaminoethoxy)- (5CI) |
| CAS: | 102207-76-1 |
| Molecular Formula: | C14H26 N4 O |
| Molecular Weight: | 266.44 |
| InChI: | InChI=1/C14H26N4O/c1-11(2)9-18(10-12(3)4)7-8-19-13-5-6-16-14(15)17-13/h5-6,11-12H,7-10H2,1-4H3,(H2,15,16,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205°C |
| Boiling Point: | 415.3°Cat760mmHg |
| Density: | 1.029g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
2-Amino-4-di-isobutylaminoethoxypyrimidine ,its cas register number is 102207-76-1. It also can be called 2-Amino-4-(2-diisobutylaminoethoxy)pyrimidine ; and Pyrimidine, 2-amino-4-(2-diisobutylaminoethoxy)- . |
| Flash Point: | 205°C |
| Safety Data | |
 |
|
