| Identification | |
| Name: | Propanenitrile,3-(2-ethylbutoxy)- |
| Synonyms: | Propionitrile,3-(2-ethylbutoxy)- (8CI); 3-(2-Ethylbutoxy)propionitrile |
| CAS: | 10232-91-4 |
| EINECS: | 233-555-4 |
| Molecular Formula: | C9H17 N O |
| Molecular Weight: | 155.27 |
| InChI: | InChI=1/C9H17NO/c1-3-9(4-2)8-11-7-5-6-10/h9H,3-5,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 102.4°C |
| Boiling Point: | 246.2°Cat760mmHg |
| Density: | 0.875g/cm3 |
| Refractive index: | 1.425 |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 102.4°C |
| Safety Data | |
 |
|
