Identification |
Name: | Propanenitrile,3-(2-ethylbutoxy)- |
Synonyms: | Propionitrile,3-(2-ethylbutoxy)- (8CI); 3-(2-Ethylbutoxy)propionitrile |
CAS: | 10232-91-4 |
EINECS: | 233-555-4 |
Molecular Formula: | C9H17 N O |
Molecular Weight: | 155.27 |
InChI: | InChI=1/C9H17NO/c1-3-9(4-2)8-11-7-5-6-10/h9H,3-5,7-8H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 102.4°C |
Boiling Point: | 246.2°Cat760mmHg |
Density: | 0.875g/cm3 |
Refractive index: | 1.425 |
Report: |
Cyanide and its compounds are on the Community Right-To-Know List.
|
Flash Point: | 102.4°C |
Safety Data |
|
 |