| Identification | |
| Name: | b-D-Xylopyranoside, 2-nitrophenyl |
| Synonyms: | 2-Nitrophenyl b-D-xylopyranoside;o-Nitrophenyl b-D-xylopyranoside;Xylopyranoside,o-nitrophenyl (7CI);Xylopyranoside, o-nitrophenyl, b-D- (8CI); |
| CAS: | 10238-27-4 |
| EINECS: | 233-571-1 |
| Molecular Formula: | C11H13NO7 |
| Molecular Weight: | 271.22342 |
| InChI: | InChI=1S/C11H13NO7/c13-7-5-18-11(10(15)9(7)14)19-8-4-2-1-3-6(8)12(16)17/h1-4,7,9-11,13-15H,5H2/t7-,9+,10-,11+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.597 g/cm3 |
| Refractive index: | 1.654 |
| Water Solubility: | Soluble in DMSO and DMFO |
| Solubility: | Soluble in DMSO and DMFO |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
