| Identification | |
| Name: | 1,3-Propanediamine,N1,N3-bis(phenylmethyl)- |
| Synonyms: | 1,3-Propanediamine,N,N'-bis(phenylmethyl)- (9CI);1,3-Propanediamine, N,N'-dibenzyl- (6CI,8CI);N,N'-Dibenzyl-1,3-diaminopropane;N,N'-Dibenzyl-1,3-propanediamine;N,N'-Dibenzyl-1,3-propylenediamine;N,N'-Dibenzyltrimethylenediamine; |
| CAS: | 10239-34-6 |
| Molecular Formula: | C17H22N2 |
| Molecular Weight: | 254.37 |
| InChI: | InChI=1/C17H22N2/c1-3-8-16(9-4-1)14-18-12-7-13-19-15-17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.017 g/cm3 |
| Refractive index: | 1.564 |
| Specification: |
The N,N'-Dibenzyl-1,3-propanediamine with cas registry number of 10239-34-6, belongs to the following product categorie: Polyamines. This chemical has the systematic name of N,N'-dibenzylpropane-1,3-diamine. Besides this, it is also named 1,3-propanediamine, N~1~,N~3~-bis(phenylmethyl)-. Physical properties about this chemical are: (1)ACD/LogP: 3.35; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.75; (4)ACD/LogD (pH 7.4): 0.03; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 8; (12)Polar Surface Area: 6.48 Å2; (13)Index of Refraction: 1.564; (14)Molar Refractivity: 81.37 cm3; (15)Molar Volume: 250.1 cm3; (16)Polarizability: 32.26×10-24cm3; (17)Surface Tension: 40.5 dyne/cm; (18)Enthalpy of Vaporization: 63.92 kJ/mol; (19)Vapour Pressure: 2.77E-06 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
