| Identification |
| Name: | Sulfamic acid,N-cyclohexyl-, compd. with N-(3-phenylpropoxy)guanidine (1:1) |
| Synonyms: | Cyclohexanesulfamicacid, compd. with (3-phenylpropoxy)guanidine (1:1) (8CI); Cyclohexanesulfamicacid, compd. with (3-phenylpropoxy)guanidine (7CI); Sulfamic acid, cyclohexyl-,compd. with (3-phenylpropoxy)guanidine (1:1) (9CI); Guanidine,(3-phenylpropoxy)-, cyclohexanesulfamate; Guanidine, (3-phenylpropoxy)-,mono(cyclohexylsulfamate) (9CI); Guanidine, (3-phenylpropoxy)-,monocyclohexanesulfamate (8CI); (3-Phenylpropoxy)guanidinecyclohexanesulfamate; U 16178F |
| CAS: | 10246-73-8 |
| Molecular Formula: | C10 H15 N3 O |
| Molecular Weight: | 372.4829 |
| InChI: | InChI=1/C10H15N3O.C6H13NO3S/c11-10(12)13-14-8-4-7-9-5-2-1-3-6-9;8-11(9,10)7-6-4-2-1-3-5-6/h1-3,5-6H,4,7-8H2,(H4,11,12,13);6-7H,1-5H2,(H,8,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 166.5°C |
| Boiling Point: | 351.7°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 166.5°C |
| Safety Data |
| |
 |
