Identification |
Name: | Argentate(1-),bis(2-hydroxypropanoato-O1,O2)-, ammonium, (T-4)- (9CI) |
Synonyms: | Propanoicacid, 2-hydroxy-, silver complex |
CAS: | 102492-24-0 |
Molecular Formula: | C6H10 Ag O6 . H4 N |
Molecular Weight: | 304.08 |
InChI: | InChI=1/C3H6O3.Ag.H3N/c1-2(4)3(5)6;;/h2,4H,1H3,(H,5,6);;1H3/q;+1; |
Molecular Structure: |
|
Properties |
Flash Point: | 109.9°C |
Boiling Point: | 227.6°Cat760mmHg |
Density: | g/cm3 |
Report: |
Silver and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory.
|
Flash Point: | 109.9°C |
Safety Data |
|
|