| Identification | |
| Name: | Glycine,N-phenyl- |
| Synonyms: | H-DL-Phg-OH;TR-NPG;(Phenylamino)aceticacid;Acetic acid, (phenylamino)-;Anilinoacetic acid;N-(Phenylamino)aceticacid;N-Phenylglycine;NSC 83567; |
| CAS: | 103-01-5 |
| EINECS: | 203-070-2 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1S/C8H9NO2/c10-8(11)6-9-7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 121-127 ºC |
| Density: | 1.259 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | moderately soluble in water |
| Solubility: | moderately soluble in water |
| Appearance: | Yellow powder |
| Specification: | ochre to yellow-brown fine powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Safety Data | |
 |
|
