Identification |
Name: | Phenol,4-[(phenylmethyl)amino]- |
Synonyms: | Phenol,p-(benzylamino)- (6CI,7CI,8CI); 4-(Benzylamino)phenol; 4-N-Benzylaminophenol;4-[(Phenylmethyl)amino]phenol; N-(4-Hydroxyphenyl)benzylamine;N-Benzyl-4-aminophenol; N-Benzyl-4-hydroxyaniline; N-Benzyl-p-aminophenol;p-(Benzylamino)phenol; p-(N-benzylamino)phenol |
CAS: | 103-14-0 |
EINECS: | 203-082-8 |
Molecular Formula: | C13H13 N O |
Molecular Weight: | 199.25 |
InChI: | InChI=1/C13H13NO/c15-13-8-6-12(7-9-13)14-10-11-4-2-1-3-5-11/h1-9,14-15H,10H2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 83 ºC |
Flash Point: | 159.1 ºC |
Boiling Point: | 195 ºC / 5mmHg |
Density: | 1.185 g/cm3 |
Refractive index: | 1.662 |
Appearance: | off-white solid |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 159.1 ºC |
Safety Data |
|
 |