| Identification | |
| Name: | Benzenepropanoic acid,methyl ester |
| Synonyms: | Methyldihydrocinnamate;Methyl hydrocinnamate;Methyl b-phenylpropionate;NSC 10128;NSC 404188;b-Phenylpropionic acid methylester;Hydrocinnamicacid, methyl ester (6CI,7CI,8CI);3-Phenylpropanoic acid methyl ester;3-Phenylpropionic acid methyl ester;Dihydrocinnamic acid methyl ester;Methyl3-phenylpropanoate;Methyl benzenepropanoate; |
| CAS: | 103-25-3 |
| EINECS: | 203-092-2 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.05 |
| Refractive index: | n20/D 1.502(lit.) |
| Appearance: | White crystal |
| Specification: | Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
