| Identification | |
| Name: | Propanoic acid,2-methyl-, phenylmethyl ester |
| Synonyms: | Isobutyricacid, benzyl ester (6CI,7CI,8CI);Benzyl 2-methylpropionate;Benzylisobutanoate;Benzyl isobutyrate;NSC 406201;NSC 46112;Phenylmethyl2-methylpropanoate; |
| CAS: | 103-28-6 |
| EINECS: | 203-095-9 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3/PG 3 |
| Density: | 0.99 |
| Refractive index: | n20/D 1.49(lit.) |
| Water Solubility: | insoluble in water and glycerin, soluble in organic solvents, oils |
| Solubility: | insoluble in water and glycerin, soluble in organic solvents, oils |
| Appearance: | colourless liquid with a fresh, fruity-floral odour |
| Specification: |
Appearance: colourless liquid with a fresh, fruity-floral odour. |
| Safety Data | |
 |
|
