| Identification | |
| Name: | N-Phenylbenzylamine |
| Synonyms: | N-Benzylaniline |
| CAS: | 103-32-2 |
| EINECS: | 203-100-4 |
| Molecular Formula: | C13H13N |
| Molecular Weight: | 183.25 |
| InChI: | InChI=1/C13H13N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10,14H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.069 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.5325(lit.) |
| Water Solubility: | INSOLUBLE |
| Solubility: | AUTOIGNITION |
| Appearance: | colorless to pale yellow crystalline powder |
| Specification: | colorless to yellow-beige crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29214980 |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
