| Identification | |
| Name: | Rubber accelerator DTDM |
| Synonyms: | Morpholine,4,4'-dithiodi- (6CI,7CI,8CI);4,4'-Dithiobis[morpholine];4,4'-Dithiodimorpholine;Accel R;Actor R;Bismorpholine disulfide;Bismorpholino disulfide;DTDM;Deovulc M;Di(4-morpholinyl) disulfide;Morpholine disulfide;Morpholinodisulfide;N,N'-Bismorpholine disulfide;N,N'-Dimorpholinyl disulfide;N,N'-Dithiobis[morpholine];N,N'-Dithiodimorpholine;NSC 65239;Nocmaster R 80E;Rhenocure M;RhenocureM/G;Sanfel R;Sulfasan;Sulfasan DTDM;Sulfasan R;Vanax A;Vulnoc R;Rubber accelerator DTDM; |
| CAS: | 103-34-4 |
| EINECS: | 203-103-0 |
| Molecular Formula: | C8H16N2O2S2 |
| Molecular Weight: | 236.35 |
| InChI: | InChI=1/C8H16N2O2S2/c1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10/h1-8H2 |
| Molecular Structure: | ![(C8H16N2O2S2) Morpholine,4,4'-dithiodi- (6CI,7CI,8CI);4,4'-Dithiobis[morpholine];4,4'-Dithiodimorpholine;Accel R;A...](https://img.guidechem.com/casimg/103-34-4.gif) |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.33 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
? 4,4'-Dithiodimorpholine?with cas registry number of 103-34-4 is also called?Di(morpholin-4-yl) disulphide ; Morpholine, 4,4'-dithiobis- ;?N,N'-Bismorpholine disulfide ; N,N'-Dithiodimorfolin ; N,N'-Dithiodimorfolin [Czech] ; N,N-Dithiodimorpholine ; Sanfel R ; Sulfasan ; Sulfasan R ; USAF B-17 ; USAF EK-T-6645 ; Vanax A ; Vulnoc?; Morpholine, 4,4'-dithiodi- .?It is applicable to be natural rubber and synthetic rubber. |
| Storage Temperature: | Refrigerator |
| Color: | CRYSTALS GRAY TO TAN POWDER |
| Usage: | Staining protector in rubber, in vulcanization of rubber, fungicide. |
| Safety Data | |
 |
|
