| Identification | |
| Name: | Benzenemethanamine,N-(phenylmethyl)- |
| Synonyms: | Dibenzylamine(8CI); (N-Benzylaminomethyl)benzene; Bibenzylamine; DBA; N,N-Dibenzylamine;N-(Phenylmethyl)benzenemethanamine; N-Benzylbenzylamine; NSC 4811 |
| CAS: | 103-49-1 |
| EINECS: | 203-117-7 |
| Molecular Formula: | C14H15N |
| Molecular Weight: | 197.28 |
| InChI: | InChI=1/C14H15N/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.026 |
| Stability: | Stable. Incompatible with oxidizing agents, acid anhydrides, acids, acid chlorides, chloroformates. |
| Refractive index: | 1.574-1.576 |
| Solubility: | 0.05 g/L (20 oC) |
| Appearance: | yellow liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:26-61-45-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 61:Avoid release to the environment. Refer to special instructions safety data sheet 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Detection of cobalt, cyanate and iron. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
