Identification |
Name: | 2-Propenoic acid,3-phenyl-, 2-phenylethyl ester |
Synonyms: | Cinnamicacid, phenethyl ester (6CI,7CI,8CI);2-Phenylethyl 3-phenyl-2-propenoate;2-Phenylethyl cinnamate;Benzylcarbinyl cinnamate;NSC 16962;Phenethylcinnamate;b-Phenethyl cinnamate;b-Phenylethyl cinnamate; |
CAS: | 103-53-7 |
EINECS: | 203-120-3 |
Molecular Formula: | C17H16O2 |
Molecular Weight: | 252.31 |
InChI: | InChI=1/C17H16O2/c18-17(12-11-15-7-3-1-4-8-15)19-14-13-16-9-5-2-6-10-16/h1-12H,13-14H2/b12-11+ |
Molecular Structure: |
|
Properties |
Density: | 1.108g/cm3 |
Refractive index: | 1.598 |
Solubility: | Soluble in hot ethanol and oil, insoluble in water |
Appearance: | White crystals or amorphous powder |
Specification: |
?BENZYLCARBINYL CINNAMATE (103-53-7)?has some other names such as B-PHENYLETHYL CINNAMATE ; Benzylcarbinyl 3-phenyl propenoate ; benzylcarbinyl cinnamate ; BETA PHENYL ETHYL CINNAMATE ; FEMA 2863 ; 2-Phenylethyl 3-phenyl propenoate ; 2-phenylethyl cinnamate ; PHENYLETHYL CINNAMATE .?BENZYLCARBINYL CINNAMATE (103-53-7) belongs to cinnamic acid.
|
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|