| Identification | |
| Name: | 2-Propen-1-ol,3-phenyl-, 1-acetate |
| Synonyms: | 2-Propen-1-ol,3-phenyl-, acetate (9CI);Cinnamyl alcohol, acetate (6CI,7CI,8CI);1-Acetoxy-3-phenyl-2-propene;3-Phenyl-2-propen-1-ol acetate;3-Phenyl-2-propen-1-yl acetate;3-Phenyl-2-propenyl acetate;3-Phenylallylacetate;Acetic acid 3-phenyl-2-propenyl ester;Acetic acid cinnamyl ester;NSC 46109;g-Phenylallyl acetate; |
| CAS: | 103-54-8 |
| EINECS: | 203-121-9 |
| Molecular Formula: | C11H12O2 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C11H12O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-8H,9H2,1H3/b8-5+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.054 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54-1.543 |
| Solubility: | Immiscible with most non-volatile oil, insoluble in water |
| Appearance: | colorless to yellow clear liquid |
| Specification: |
?Cinnamyl acetate (CAS NO.103-54-8) is a clear colorless to pale yellowish liquid with?acetic odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
