| Identification | |
| Name: | Propanoic acid,2-methyl-, 3-phenyl-2-propen-1-yl ester |
| Synonyms: | Isobutyricacid, cinnamyl ester (6CI,7CI,8CI);Propanoic acid, 2-methyl-,3-phenyl-2-propenyl ester (9CI);Cinnamyl alcohol, isobutyrate (8CI);3-Phenyl-2-propen-1-yl isobutyrate;NSC 46133; |
| CAS: | 103-59-3 |
| EINECS: | 203-126-6 |
| Molecular Formula: | C13H16O2 |
| Molecular Weight: | 204.26 |
| InChI: | InChI=1/C13H16O2/c1-11(2)13(14)15-10-6-9-12-7-4-3-5-8-12/h3-9,11H,10H2,1-2H3/b9-6+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.008 |
| Refractive index: | 1.524 |
| Water Solubility: | insoluble in water; soluble in oils |
| Solubility: | insoluble in water; soluble in oils |
| Appearance: | Colourless to yellowish liquid, sweet, balsamic fruity odour |
| Specification: |
Product Categories about Cinnamyl Isobutyrate (CAS NO.103-59-3) are Alphabetical Listings ; C-D ; Flavors and Fragrances . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
