| Identification | |
| Name: | Phenol, 4-(butylamino)- |
| Synonyms: | Phenol,p-(butylamino)- (6CI,7CI,8CI); 4-(Butylamino)phenol; Du Pont GasolineAntioxidant No. 5; N-Butyl-4-aminophenol; N-Butyl-p-aminophenol; NSC 404034;p-(Butylamino)phenol; p-Hydroxyphenyl-n-butylamine |
| CAS: | 103-62-8 |
| EINECS: | 203-129-2 |
| Molecular Formula: | C10H15 N O |
| Molecular Weight: | 165.26 |
| InChI: | InChI=1/C10H15NO/c1-2-3-8-11-9-4-6-10(12)7-5-9/h4-7,11-12H,2-3,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.9°C |
| Boiling Point: | 302.9°Cat760mmHg |
| Density: | 1.053g/cm3 |
| Refractive index: | 1.572 |
| Specification: |
4-(Butylamino)phenol (CAS NO.103-62-8) is also called 3-13-00-01014 (Beilstein Handbook Reference) ; AI3-16924 ; BRN 2690441 ; Du Pont Gasoline Antioxidant No. 5 ; N-Butyl-p-aminophenol ; N-Butylated-para-aminophenol ; N-n-Butyl-p-aminophenol ; NSC 404034 ; Phenol, p-(butylamino)- ; Tenamene 1 ; p-(Butylamino)phenol ; p-Hydroxyphenyl-n-butylamine . 4-(Butylamino)phenol (CAS NO.103-62-8) is moderate toxic. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 128.9°C |
| Safety Data | |
 |
|
