| Identification | |
| Name: | Phenylacetyl chloride |
| Synonyms: | Benzeneacetyl chloride; Phenacetyl chloride; Phenylacetic acid chloride; Phenylacetyl chloride; |
| CAS: | 103-80-0 |
| EINECS: | 203-146-5 |
| Molecular Formula: | C8H7ClO |
| Molecular Weight: | 154.6 |
| InChI: | InChI=1/C8H7ClO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2577 |
| Melting Point: | 91 |
| Density: | 1.16 |
| Stability: | Stable. Reacts with water. Incompatible with amines, most common metals, moisture, strong oxidizing agents. |
| Refractive index: | 1.532-1.533 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes |
| Appearance: | clear liquid |
| Specification: | colourless liquid Safety Statements:26-36/37/39-45-25-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 25:Avoid contact with eyes 27:Take off immediately all contaminated clothing |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Refrigerator (approx 4 C). Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
